C14H12Br4O5 — CID 70478657
3,4,5,6-tetrabromo-1-(1-hydroxyprop-2-enyl)-2-prop-2-enylcyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 70478657) has the molecular formula C14H12Br4O5 and a molecular weight of 579.86 g/mol. Its IUPAC name is 3,4,5,6-tetrabromo-1-(1-hydroxyprop-2-enyl)-2-prop-2-enylcyclohexa-3,5-diene-1,2-dicarboxylic acid.
| Compound Name | 3,4,5,6-tetrabromo-1-(1-hydroxyprop-2-enyl)-2-prop-2-enylcyclohexa-3,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 70478657 |
| Molecular Formula | C14H12Br4O5 |
| Molecular Weight | 579.86 g/mol |
| Exact Mass | 575.74 |
| IUPAC Name | 3,4,5,6-tetrabromo-1-(1-hydroxyprop-2-enyl)-2-prop-2-enylcyclohexa-3,5-diene-1,2-dicarboxylic acid |
| SMILES | C=CCC1(C(=O)O)C(Br)=C(Br)C(Br)=C(Br)C1(C(=O)O)C(O)C=C |
| InChI | InChI=1S/C14H12Br4O5/c1-3-5-13(11(20)21)9(17)7(15)8(16)10(18)14(13,12(22)23)6(19)4-2/h3-4,6,19H,1-2,5H2,(H,20,21)(H,22,23) |
| InChIKey | YGUPTFIYABJOPL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.86 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|