C24H28Br4O8 — CID 70633346
3,4,5,6-tetrabromo-1,2-bis[(2-ethenyl-5-methyl-1,3-dioxan-5-yl)methyl]cyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 70633346) has the molecular formula C24H28Br4O8 and a molecular weight of 764.10 g/mol. Its IUPAC name is 3,4,5,6-tetrabromo-1,2-bis[(2-ethenyl-5-methyl-1,3-dioxan-5-yl)methyl]cyclohexa-3,5-diene-1,2-dicarboxylic acid.
| Compound Name | 3,4,5,6-tetrabromo-1,2-bis[(2-ethenyl-5-methyl-1,3-dioxan-5-yl)methyl]cyclohexa-3,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 70633346 |
| Molecular Formula | C24H28Br4O8 |
| Molecular Weight | 764.10 g/mol |
| Exact Mass | 759.85 |
| IUPAC Name | 3,4,5,6-tetrabromo-1,2-bis[(2-ethenyl-5-methyl-1,3-dioxan-5-yl)methyl]cyclohexa-3,5-diene-1,2-dicarboxylic acid |
| SMILES | C=CC1OCC(C)(CC2(C(=O)O)C(Br)=C(Br)C(Br)=C(Br)C2(CC2(C)COC(C=C)OC2)C(=O)O)CO1 |
| InChI | InChI=1S/C24H28Br4O8/c1-5-13-33-9-21(3,10-34-13)7-23(19(29)30)17(27)15(25)16(26)18(28)24(23,20(31)32)8-22(4)11-35-14(6-2)36-12-22/h5-6,13-14H,1-2,7-12H2,3-4H3,(H,29,30)(H,31,32) |
| InChIKey | HYVDCSSQSXVWGL-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.10 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|