C20H35ClN2 — CID 70480421
3-dodecyl-3-methyl-1,2-dihydrobenzimidazol-3-ium chloride (PubChem CID 70480421) has the molecular formula C20H35ClN2 and a molecular weight of 338.97 g/mol. Its IUPAC name is 3-dodecyl-3-methyl-1,2-dihydrobenzimidazol-3-ium chloride.
| Compound Name | 3-dodecyl-3-methyl-1,2-dihydrobenzimidazol-3-ium chloride |
|---|---|
| PubChem CID | 70480421 |
| Molecular Formula | C20H35ClN2 |
| Molecular Weight | 338.97 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 3-dodecyl-3-methyl-1,2-dihydrobenzimidazol-3-ium chloride |
| SMILES | CCCCCCCCCCCC[N+]1(C)CNc2ccccc21.[Cl-] |
| InChI | InChI=1S/C20H35N2.ClH/c1-3-4-5-6-7-8-9-10-11-14-17-22(2)18-21-19-15-12-13-16-20(19)22;/h12-13,15-16,21H,3-11,14,17-18H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | ZAWODKJJHGWZHU-UHFFFAOYSA-M |
| XLogP | 2.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.97 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|