C20H22N2O4 — CID 70483071
(2S,3S)-3-(1,3-benzoxazol-2-ylmethylamino)-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 70483071) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is (2S,3S)-3-(1,3-benzoxazol-2-ylmethylamino)-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (2S,3S)-3-(1,3-benzoxazol-2-ylmethylamino)-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 70483071 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (2S,3S)-3-(1,3-benzoxazol-2-ylmethylamino)-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | COc1ccc(OC)c2c1C[C@H](NCc1nc3ccccc3o1)[C@@H](O)C2 |
| InChI | InChI=1S/C20H22N2O4/c1-24-17-7-8-18(25-2)13-10-16(23)15(9-12(13)17)21-11-20-22-14-5-3-4-6-19(14)26-20/h3-8,15-16,21,23H,9-11H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | IOVUZQHPVTYHRD-HOTGVXAUSA-N |
| XLogP | 2.46 |
| TPSA | 76.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |