C23H35N4O3+ — CID 7048890
diethyl-[(4R)-4-[[2,4,6-trioxo-1-(2,4,6-trimethylphenyl)-1,3-diazinan-5-yl]methylideneamino]pentyl]azanium (PubChem CID 7048890) has the molecular formula C23H35N4O3+ and a molecular weight of 415.56 g/mol. Its IUPAC name is diethyl-[(4R)-4-[[2,4,6-trioxo-1-(2,4,6-trimethylphenyl)-1,3-diazinan-5-yl]methylideneamino]pentyl]azanium.
| Compound Name | diethyl-[(4R)-4-[[2,4,6-trioxo-1-(2,4,6-trimethylphenyl)-1,3-diazinan-5-yl]methylideneamino]pentyl]azanium |
|---|---|
| PubChem CID | 7048890 |
| Molecular Formula | C23H35N4O3+ |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | diethyl-[(4R)-4-[[2,4,6-trioxo-1-(2,4,6-trimethylphenyl)-1,3-diazinan-5-yl]methylideneamino]pentyl]azanium |
| SMILES | CC[NH+](CC)CCC[C@@H](C)/N=C/C1C(=O)NC(=O)N(c2c(C)cc(C)cc2C)C1=O |
| InChI | InChI=1S/C23H34N4O3/c1-7-26(8-2)11-9-10-18(6)24-14-19-21(28)25-23(30)27(22(19)29)20-16(4)12-15(3)13-17(20)5/h12-14,18-19H,7-11H2,1-6H3,(H,25,28,30)/p+1/b24-14+/t18-,19?/m1/s1 |
| InChIKey | UYXSHCCCQHNXLM-RFIANBOBSA-O |
| XLogP | 1.98 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|