C19H13ClN2O3 — CID 70491285
(6E)-6-(1,3-benzodioxol-5-ylmethylidene)-12-chloro-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one (PubChem CID 70491285) has the molecular formula C19H13ClN2O3 and a molecular weight of 352.78 g/mol. Its IUPAC name is (6E)-6-(1,3-benzodioxol-5-ylmethylidene)-12-chloro-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one.
| Compound Name | (6E)-6-(1,3-benzodioxol-5-ylmethylidene)-12-chloro-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one |
|---|---|
| PubChem CID | 70491285 |
| Molecular Formula | C19H13ClN2O3 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | (6E)-6-(1,3-benzodioxol-5-ylmethylidene)-12-chloro-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one |
| SMILES | O=c1c2c(nc3ccc(Cl)cn13)/C(=C/c1ccc3c(c1)OCO3)CC2 |
| InChI | InChI=1S/C19H13ClN2O3/c20-13-3-6-17-21-18-12(2-4-14(18)19(23)22(17)9-13)7-11-1-5-15-16(8-11)25-10-24-15/h1,3,5-9H,2,4,10H2/b12-7+ |
| InChIKey | GGFJCEXIYJPMDN-KPKJPENVSA-N |
| XLogP | 3.56 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |