C44H67NO4 — CID 70494513
N-[(2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-N,3,7,11,15,19,23,27-octamethyloctacosa-2,6,10,14,18,22,26-heptaenamide (PubChem CID 70494513) has the molecular formula C44H67NO4 and a molecular weight of 674.02 g/mol. Its IUPAC name is N-[(2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-N,3,7,11,15,19,23,27-octamethyloctacosa-2,6,10,14,18,22,26-heptaenamide.
| Compound Name | N-[(2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-N,3,7,11,15,19,23,27-octamethyloctacosa-2,6,10,14,18,22,26-heptaenamide |
|---|---|
| PubChem CID | 70494513 |
| Molecular Formula | C44H67NO4 |
| Molecular Weight | 674.02 g/mol |
| Exact Mass | 673.51 |
| IUPAC Name | N-[(2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-N,3,7,11,15,19,23,27-octamethyloctacosa-2,6,10,14,18,22,26-heptaenamide |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC(=O)N(C)C[C@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C44H67NO4/c1-33(2)16-10-17-34(3)18-11-19-35(4)20-12-21-36(5)22-13-23-37(6)24-14-25-38(7)26-15-27-39(8)30-44(49)45(9)32-43(48)40-28-29-41(46)42(47)31-40/h16,18,20,22,24,26,28-31,43,46-48H,10-15,17,19,21,23,25,27,32H2,1-9H3/t43-/m0/s1 |
| InChIKey | ALUQNHFTDYRGQX-QLKFWGTOSA-N |
| XLogP | 11.91 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.02 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|