C26H42O5 — CID 70495716
methyl 5-[(3aS,4S,5S,6aR)-5-(2-methoxypropan-2-yloxy)-4-(3-oxooct-1-enyl)-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-ylidene]pentanoate (PubChem CID 70495716) has the molecular formula C26H42O5 and a molecular weight of 434.62 g/mol. Its IUPAC name is methyl 5-[(3aS,4S,5S,6aR)-5-(2-methoxypropan-2-yloxy)-4-(3-oxooct-1-enyl)-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-ylidene]pentanoate.
| Compound Name | methyl 5-[(3aS,4S,5S,6aR)-5-(2-methoxypropan-2-yloxy)-4-(3-oxooct-1-enyl)-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-ylidene]pentanoate |
|---|---|
| PubChem CID | 70495716 |
| Molecular Formula | C26H42O5 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | methyl 5-[(3aS,4S,5S,6aR)-5-(2-methoxypropan-2-yloxy)-4-(3-oxooct-1-enyl)-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-ylidene]pentanoate |
| SMILES | CCCCCC(=O)C=C[C@H]1[C@H]2CCC(=CCCCC(=O)OC)[C@@H]2C[C@@H]1OC(C)(C)OC |
| InChI | InChI=1S/C26H42O5/c1-6-7-8-12-20(27)15-17-22-21-16-14-19(11-9-10-13-25(28)29-4)23(21)18-24(22)31-26(2,3)30-5/h11,15,17,21-24H,6-10,12-14,16,18H2,1-5H3/t21-,22+,23+,24+/m1/s1 |
| InChIKey | OBXBFZYARHATIU-SBFWRKJZSA-N |
| XLogP | 5.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|