C15H14N2O4 — CID 70507740
3-(2,2-dimethyl-3H-1-benzofuran-7-yl)-5-prop-1-ynoxy-1,3,4-oxadiazol-2-one (PubChem CID 70507740) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 3-(2,2-dimethyl-3H-1-benzofuran-7-yl)-5-prop-1-ynoxy-1,3,4-oxadiazol-2-one.
| Compound Name | 3-(2,2-dimethyl-3H-1-benzofuran-7-yl)-5-prop-1-ynoxy-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 70507740 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-(2,2-dimethyl-3H-1-benzofuran-7-yl)-5-prop-1-ynoxy-1,3,4-oxadiazol-2-one |
| SMILES | CC#COc1nn(-c2cccc3c2OC(C)(C)C3)c(=O)o1 |
| InChI | InChI=1S/C15H14N2O4/c1-4-8-19-13-16-17(14(18)20-13)11-7-5-6-10-9-15(2,3)21-12(10)11/h5-7H,9H2,1-3H3 |
| InChIKey | MVEZKMOGBFGJJZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 66.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|