About amino-benzyl-diphenylphosphanium;butane
amino-benzyl-diphenylphosphanium;butane (PubChem CID 70518785) has the molecular formula C23H29NP+
and a molecular weight of 350.47 g/mol. Its IUPAC name is amino-benzyl-diphenylphosphanium;butane.
Molecular Properties
| Compound Name | amino-benzyl-diphenylphosphanium;butane |
| PubChem CID | 70518785 |
| Molecular Formula | C23H29NP+ |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | amino-benzyl-diphenylphosphanium;butane |
| SMILES | CCCC.N[P+](Cc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19NP.C4H10/c20-21(18-12-6-2-7-13-18,19-14-8-3-9-15-19)16-17-10-4-1-5-11-17;1-3-4-2/h1-15H,16,20H2;3-4H2,1-2H3/q+1; |
| InChIKey | RGHBXEUTKLJCQX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze amino-benzyl-diphenylphosphanium;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino-benzyl-diphenylphosphanium;butane?
The IUPAC name of amino-benzyl-diphenylphosphanium;butane (CID 70518785) is amino-benzyl-diphenylphosphanium;butane.
What is the SMILES notation for amino-benzyl-diphenylphosphanium;butane?
The canonical SMILES for amino-benzyl-diphenylphosphanium;butane is CCCC.N[P+](Cc1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of amino-benzyl-diphenylphosphanium;butane?
The InChIKey is RGHBXEUTKLJCQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NP.C4H10/c20-21(18-12-6-2-7-13-18,19-14-8-3-9-15-19)16-17-10-4-1-5-11-17;1-3-4-2/h1-15H,16,20H2;3-4H2,1-2H3/q+1;.
What are the key properties of amino-benzyl-diphenylphosphanium;butane?
amino-benzyl-diphenylphosphanium;butane has a molecular weight of 350.47 g/mol, XLogP of 5.54, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for amino-benzyl-diphenylphosphanium;butane is sourced from PubChem (CID 70518785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).