C15H31N3 — CID 70518958
1,3-Bis(3-methylbutyl)-1,3-diazepan-2-imine (PubChem CID 70518958) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is 1,3-bis(3-methylbutyl)-1,3-diazepan-2-imine.
| Compound Name | 1,3-Bis(3-methylbutyl)-1,3-diazepan-2-imine |
|---|---|
| PubChem CID | 70518958 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | 1,3-bis(3-methylbutyl)-1,3-diazepan-2-imine |
| SMILES | CC(C)CCN1CCCCN(C1=N)CCC(C)C |
| InChI | InChI=1S/C15H31N3/c1-13(2)7-11-17-9-5-6-10-18(15(17)16)12-8-14(3)4/h13-14,16H,5-12H2,1-4H3 |
| InChIKey | BJMDLOWZMVDLQI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 30.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | 224 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|