C17H23BrClNO — CID 70540411
4-bromo-N-[(4-chlorophenyl)methyl]-N-(2-methylpropyl)hex-2-enamide (PubChem CID 70540411) has the molecular formula C17H23BrClNO and a molecular weight of 372.73 g/mol. Its IUPAC name is 4-bromo-N-[(4-chlorophenyl)methyl]-N-(2-methylpropyl)hex-2-enamide.
| Compound Name | 4-bromo-N-[(4-chlorophenyl)methyl]-N-(2-methylpropyl)hex-2-enamide |
|---|---|
| PubChem CID | 70540411 |
| Molecular Formula | C17H23BrClNO |
| Molecular Weight | 372.73 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 4-bromo-N-[(4-chlorophenyl)methyl]-N-(2-methylpropyl)hex-2-enamide |
| SMILES | CCC(Br)C=CC(=O)N(Cc1ccc(Cl)cc1)CC(C)C |
| InChI | InChI=1S/C17H23BrClNO/c1-4-15(18)7-10-17(21)20(11-13(2)3)12-14-5-8-16(19)9-6-14/h5-10,13,15H,4,11-12H2,1-3H3 |
| InChIKey | BXNAMMUBQPOZBE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.73 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|