C19H29ClO3 — CID 70542592
1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine (PubChem CID 70542592) has the molecular formula C19H29ClO3 and a molecular weight of 340.89 g/mol. Its IUPAC name is 1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine.
| Compound Name | 1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine |
|---|---|
| PubChem CID | 70542592 |
| Molecular Formula | C19H29ClO3 |
| Molecular Weight | 340.89 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine |
| SMILES | CCC(CCCCl)C1(C)OCCCc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C19H29ClO3/c1-5-15(9-6-10-20)19(2)16-13-18(22-4)17(21-3)12-14(16)8-7-11-23-19/h12-13,15H,5-11H2,1-4H3 |
| InChIKey | UOXBVAFCYPSVKH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.89 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|