About 1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine
1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine (PubChem CID 70542592) has the molecular formula C19H29ClO3
and a molecular weight of 340.89 g/mol. Its IUPAC name is 1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine.
Molecular Properties
| Compound Name | 1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine |
| PubChem CID | 70542592 |
| Molecular Formula | C19H29ClO3 |
| Molecular Weight | 340.89 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine |
| SMILES | CCC(CCCCl)C1(C)OCCCc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C19H29ClO3/c1-5-15(9-6-10-20)19(2)16-13-18(22-4)17(21-3)12-14(16)8-7-11-23-19/h12-13,15H,5-11H2,1-4H3 |
| InChIKey | UOXBVAFCYPSVKH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.89 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine?
The IUPAC name of 1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine (CID 70542592) is 1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine.
What is the SMILES notation for 1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine?
The canonical SMILES for 1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine is CCC(CCCCl)C1(C)OCCCc2cc(OC)c(OC)cc21.
What is the InChIKey of 1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine?
The InChIKey is UOXBVAFCYPSVKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29ClO3/c1-5-15(9-6-10-20)19(2)16-13-18(22-4)17(21-3)12-14(16)8-7-11-23-19/h12-13,15H,5-11H2,1-4H3.
What are the key properties of 1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine?
1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine has a molecular weight of 340.89 g/mol, XLogP of 4.93, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-chlorohexan-3-yl)-7,8-dimethoxy-1-methyl-4,5-dihydro-3H-2-benzoxepine is sourced from PubChem (CID 70542592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).