(2R,5R)-2-methyl-5-propan-2-yloxolane-2,5-dicarboxylic acid

C10H16O5 — CID 7054377

IUPAC(2R,5R)-2-methyl-5-propan-2-yloxolane-2,5-dicarboxylic acid
SMILESCC(C)[C@@]1(C(=O)O)CC[C@](C)(C(=O)O)O1
InChIInChI=1S/C10H16O5/c1-6(2)10(8(13)14)5-4-9(3,15-10)7(11)12/h6H,4-5H2,1-3H3,(H,11,12)(H,13,14)/t9-,10-/m1/s1
InChIKeyLZIXTQVXBKQFGI-NXEZZACHSA-N
MW216.23 g/mol
LogP1.12
Rot. Bonds3

About (2R,5R)-2-methyl-5-propan-2-yloxolane-2,5-dicarboxylic acid

(2R,5R)-2-methyl-5-propan-2-yloxolane-2,5-dicarboxylic acid (PubChem CID 7054377) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is (2R,5R)-2-methyl-5-propan-2-yloxolane-2,5-dicarboxylic acid.

Molecular Properties

Compound Name(2R,5R)-2-methyl-5-propan-2-yloxolane-2,5-dicarboxylic acid
PubChem CID7054377
Molecular FormulaC10H16O5
Molecular Weight216.23 g/mol
Exact Mass216.10
IUPAC Name(2R,5R)-2-methyl-5-propan-2-yloxolane-2,5-dicarboxylic acid
SMILESCC(C)[C@@]1(C(=O)O)CC[C@](C)(C(=O)O)O1
InChIInChI=1S/C10H16O5/c1-6(2)10(8(13)14)5-4-9(3,15-10)7(11)12/h6H,4-5H2,1-3H3,(H,11,12)(H,13,14)/t9-,10-/m1/s1
InChIKeyLZIXTQVXBKQFGI-NXEZZACHSA-N
XLogP1.12
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.23
LogP ≤ 51.12
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2R,5R)-2-methyl-5-propan-2-yloxolane-2,5-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,5R)-2-methyl-5-propan-2-yloxolane-2,5-dicarboxylic acid?
The IUPAC name of (2R,5R)-2-methyl-5-propan-2-yloxolane-2,5-dicarboxylic acid (CID 7054377) is (2R,5R)-2-methyl-5-propan-2-yloxolane-2,5-dicarboxylic acid.
What is the SMILES notation for (2R,5R)-2-methyl-5-propan-2-yloxolane-2,5-dicarboxylic acid?
The canonical SMILES for (2R,5R)-2-methyl-5-propan-2-yloxolane-2,5-dicarboxylic acid is CC(C)[C@@]1(C(=O)O)CC[C@](C)(C(=O)O)O1.
What is the InChIKey of (2R,5R)-2-methyl-5-propan-2-yloxolane-2,5-dicarboxylic acid?
The InChIKey is LZIXTQVXBKQFGI-NXEZZACHSA-N. The full InChI is InChI=1S/C10H16O5/c1-6(2)10(8(13)14)5-4-9(3,15-10)7(11)12/h6H,4-5H2,1-3H3,(H,11,12)(H,13,14)/t9-,10-/m1/s1.
What are the key properties of (2R,5R)-2-methyl-5-propan-2-yloxolane-2,5-dicarboxylic acid?
(2R,5R)-2-methyl-5-propan-2-yloxolane-2,5-dicarboxylic acid has a molecular weight of 216.23 g/mol, XLogP of 1.12, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-2-methyl-5-propan-2-yloxolane-2,5-dicarboxylic acid is sourced from PubChem (CID 7054377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).