(2,6-dichlorophenyl)-methylidyneazanium chloride

C7H4Cl3N — CID 70545078

IUPAC(2,6-dichlorophenyl)-methylidyneazanium chloride
SMILESC#[N+]c1c(Cl)cccc1Cl.[Cl-]
InChIInChI=1S/C7H4Cl2N.ClH/c1-10-7-5(8)3-2-4-6(7)9;/h1-4H;1H/q+1;/p-1
InChIKeySQJCLEZVPLSKCQ-UHFFFAOYSA-M
MW208.48 g/mol
LogP0.59
Rot. Bonds

About (2,6-dichlorophenyl)-methylidyneazanium chloride

(2,6-dichlorophenyl)-methylidyneazanium chloride (PubChem CID 70545078) has the molecular formula C7H4Cl3N and a molecular weight of 208.48 g/mol. Its IUPAC name is (2,6-dichlorophenyl)-methylidyneazanium chloride.

Molecular Properties

Compound Name(2,6-dichlorophenyl)-methylidyneazanium chloride
PubChem CID70545078
Molecular FormulaC7H4Cl3N
Molecular Weight208.48 g/mol
Exact Mass206.94
IUPAC Name(2,6-dichlorophenyl)-methylidyneazanium chloride
SMILESC#[N+]c1c(Cl)cccc1Cl.[Cl-]
InChIInChI=1S/C7H4Cl2N.ClH/c1-10-7-5(8)3-2-4-6(7)9;/h1-4H;1H/q+1;/p-1
InChIKeySQJCLEZVPLSKCQ-UHFFFAOYSA-M
XLogP0.59
TPSA4.36 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.48
LogP ≤ 50.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Analyze (2,6-dichlorophenyl)-methylidyneazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,6-dichlorophenyl)-methylidyneazanium chloride?
The IUPAC name of (2,6-dichlorophenyl)-methylidyneazanium chloride (CID 70545078) is (2,6-dichlorophenyl)-methylidyneazanium chloride.
What is the SMILES notation for (2,6-dichlorophenyl)-methylidyneazanium chloride?
The canonical SMILES for (2,6-dichlorophenyl)-methylidyneazanium chloride is C#[N+]c1c(Cl)cccc1Cl.[Cl-].
What is the InChIKey of (2,6-dichlorophenyl)-methylidyneazanium chloride?
The InChIKey is SQJCLEZVPLSKCQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H4Cl2N.ClH/c1-10-7-5(8)3-2-4-6(7)9;/h1-4H;1H/q+1;/p-1.
What are the key properties of (2,6-dichlorophenyl)-methylidyneazanium chloride?
(2,6-dichlorophenyl)-methylidyneazanium chloride has a molecular weight of 208.48 g/mol, XLogP of 0.59, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dichlorophenyl)-methylidyneazanium chloride is sourced from PubChem (CID 70545078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).