methyl 3-(6-bromooxy-5-hept-5-en-2-yloxan-2-yl)propanoate

C16H27BrO4 — CID 70552002

IUPACmethyl 3-(6-bromooxy-5-hept-5-en-2-yloxan-2-yl)propanoate
SMILESCC=CCCC(C)C1CCC(CCC(=O)OC)OC1OBr
InChIInChI=1S/C16H27BrO4/c1-4-5-6-7-12(2)14-10-8-13(20-16(14)21-17)9-11-15(18)19-3/h4-5,12-14,16H,6-11H2,1-3H3
InChIKeyAJEVWIFBNGEQMK-UHFFFAOYSA-N
MW363.29 g/mol
LogP4.38
Rot. Bonds8

About methyl 3-(6-bromooxy-5-hept-5-en-2-yloxan-2-yl)propanoate

methyl 3-(6-bromooxy-5-hept-5-en-2-yloxan-2-yl)propanoate (PubChem CID 70552002) has the molecular formula C16H27BrO4 and a molecular weight of 363.29 g/mol. Its IUPAC name is methyl 3-(6-bromooxy-5-hept-5-en-2-yloxan-2-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(6-bromooxy-5-hept-5-en-2-yloxan-2-yl)propanoate
PubChem CID70552002
Molecular FormulaC16H27BrO4
Molecular Weight363.29 g/mol
Exact Mass362.11
IUPAC Namemethyl 3-(6-bromooxy-5-hept-5-en-2-yloxan-2-yl)propanoate
SMILESCC=CCCC(C)C1CCC(CCC(=O)OC)OC1OBr
InChIInChI=1S/C16H27BrO4/c1-4-5-6-7-12(2)14-10-8-13(20-16(14)21-17)9-11-15(18)19-3/h4-5,12-14,16H,6-11H2,1-3H3
InChIKeyAJEVWIFBNGEQMK-UHFFFAOYSA-N
XLogP4.38
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500363.29
LogP ≤ 54.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl 3-(6-bromooxy-5-hept-5-en-2-yloxan-2-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(6-bromooxy-5-hept-5-en-2-yloxan-2-yl)propanoate?
The IUPAC name of methyl 3-(6-bromooxy-5-hept-5-en-2-yloxan-2-yl)propanoate (CID 70552002) is methyl 3-(6-bromooxy-5-hept-5-en-2-yloxan-2-yl)propanoate.
What is the SMILES notation for methyl 3-(6-bromooxy-5-hept-5-en-2-yloxan-2-yl)propanoate?
The canonical SMILES for methyl 3-(6-bromooxy-5-hept-5-en-2-yloxan-2-yl)propanoate is CC=CCCC(C)C1CCC(CCC(=O)OC)OC1OBr.
What is the InChIKey of methyl 3-(6-bromooxy-5-hept-5-en-2-yloxan-2-yl)propanoate?
The InChIKey is AJEVWIFBNGEQMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27BrO4/c1-4-5-6-7-12(2)14-10-8-13(20-16(14)21-17)9-11-15(18)19-3/h4-5,12-14,16H,6-11H2,1-3H3.
What are the key properties of methyl 3-(6-bromooxy-5-hept-5-en-2-yloxan-2-yl)propanoate?
methyl 3-(6-bromooxy-5-hept-5-en-2-yloxan-2-yl)propanoate has a molecular weight of 363.29 g/mol, XLogP of 4.38, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(6-bromooxy-5-hept-5-en-2-yloxan-2-yl)propanoate is sourced from PubChem (CID 70552002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).