C22H36O5 — CID 70553290
(2R,3R,4R)-4-hydroxy-3-(4-hydroxy-4-methyloct-5-enyl)-2-[(Z)-8-hydroxy-7-oxooct-3-enyl]cyclopentan-1-one (PubChem CID 70553290) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is (2R,3R,4R)-4-hydroxy-3-(4-hydroxy-4-methyloct-5-enyl)-2-[(Z)-8-hydroxy-7-oxooct-3-enyl]cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-4-hydroxy-3-(4-hydroxy-4-methyloct-5-enyl)-2-[(Z)-8-hydroxy-7-oxooct-3-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 70553290 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | (2R,3R,4R)-4-hydroxy-3-(4-hydroxy-4-methyloct-5-enyl)-2-[(Z)-8-hydroxy-7-oxooct-3-enyl]cyclopentan-1-one |
| SMILES | CCC=CC(C)(O)CCC[C@H]1[C@H](O)CC(=O)[C@@H]1CC/C=C\CCC(=O)CO |
| InChI | InChI=1S/C22H36O5/c1-3-4-13-22(2,27)14-9-12-19-18(20(25)15-21(19)26)11-8-6-5-7-10-17(24)16-23/h4-6,13,18-19,21,23,26-27H,3,7-12,14-16H2,1-2H3/b6-5-,13-4?/t18-,19-,21-,22?/m1/s1 |
| InChIKey | BEBYDVRYYSENSG-BLUOJMJESA-N |
| XLogP | 3.12 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|