C22H38O4 — CID 70593490
(2R,3R,4R)-3-(4-ethenyl-4-hydroxyoctyl)-4-hydroxy-2-[(E)-7-hydroxyhept-6-enyl]cyclopentan-1-one (PubChem CID 70593490) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is (2R,3R,4R)-3-(4-ethenyl-4-hydroxyoctyl)-4-hydroxy-2-[(E)-7-hydroxyhept-6-enyl]cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-3-(4-ethenyl-4-hydroxyoctyl)-4-hydroxy-2-[(E)-7-hydroxyhept-6-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 70593490 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | (2R,3R,4R)-3-(4-ethenyl-4-hydroxyoctyl)-4-hydroxy-2-[(E)-7-hydroxyhept-6-enyl]cyclopentan-1-one |
| SMILES | C=CC(O)(CCCC)CCC[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCC/C=C/O |
| InChI | InChI=1S/C22H38O4/c1-3-5-14-22(26,4-2)15-11-13-19-18(20(24)17-21(19)25)12-9-7-6-8-10-16-23/h4,10,16,18-19,21,23,25-26H,2-3,5-9,11-15,17H2,1H3/b16-10+/t18-,19-,21-,22?/m1/s1 |
| InChIKey | KIBAIPHZPZKZPS-QYAIREGGSA-N |
| XLogP | 4.85 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|