C23H40O6 — CID 70596450
(2R,3R,4R)-2-(6,8-dihydroxy-7-oxooct-5-enyl)-4-hydroxy-3-(4-hydroxy-4-methylnonyl)cyclopentan-1-one (PubChem CID 70596450) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is (2R,3R,4R)-2-(6,8-dihydroxy-7-oxooct-5-enyl)-4-hydroxy-3-(4-hydroxy-4-methylnonyl)cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-2-(6,8-dihydroxy-7-oxooct-5-enyl)-4-hydroxy-3-(4-hydroxy-4-methylnonyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 70596450 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (2R,3R,4R)-2-(6,8-dihydroxy-7-oxooct-5-enyl)-4-hydroxy-3-(4-hydroxy-4-methylnonyl)cyclopentan-1-one |
| SMILES | CCCCCC(C)(O)CCC[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCC=C(O)C(=O)CO |
| InChI | InChI=1S/C23H40O6/c1-3-4-8-13-23(2,29)14-9-11-18-17(20(26)15-21(18)27)10-6-5-7-12-19(25)22(28)16-24/h12,17-18,21,24-25,27,29H,3-11,13-16H2,1-2H3/t17-,18-,21-,23?/m1/s1 |
| InChIKey | GGNZDCZGGGRKOG-PGDWZWKLSA-N |
| XLogP | 3.62 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|