C30H31FO6 — CID 70565040
[(10S,11S,13S,14S,17R)-17-(2-acetyloxyacetyl)-11-fluoro-10,13-dimethyl-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] benzoate (PubChem CID 70565040) has the molecular formula C30H31FO6 and a molecular weight of 506.57 g/mol. Its IUPAC name is [(10S,11S,13S,14S,17R)-17-(2-acetyloxyacetyl)-11-fluoro-10,13-dimethyl-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] benzoate.
| Compound Name | [(10S,11S,13S,14S,17R)-17-(2-acetyloxyacetyl)-11-fluoro-10,13-dimethyl-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] benzoate |
|---|---|
| PubChem CID | 70565040 |
| Molecular Formula | C30H31FO6 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | [(10S,11S,13S,14S,17R)-17-(2-acetyloxyacetyl)-11-fluoro-10,13-dimethyl-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] benzoate |
| SMILES | CC(=O)OCC(=O)[C@@]1(OC(=O)c2ccccc2)CC[C@H]2C3=C([C@@H](F)C[C@@]21C)[C@@]1(C)C=CC(=O)C=C1CC3 |
| InChI | InChI=1S/C30H31FO6/c1-18(32)36-17-25(34)30(37-27(35)19-7-5-4-6-8-19)14-12-23-22-10-9-20-15-21(33)11-13-28(20,2)26(22)24(31)16-29(23,30)3/h4-8,11,13,15,23-24H,9-10,12,14,16-17H2,1-3H3/t23-,24-,28-,29-,30-/m0/s1 |
| InChIKey | ZIHMBKFPWYSMRX-IHIHHSMVSA-N |
| XLogP | 5.03 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|