C35H42O8S — CID 88763443
[(10S,11S,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-[2-(4-methylphenyl)sulfonyloxyacetyl]-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] cyclohexanecarboxylate (PubChem CID 88763443) has the molecular formula C35H42O8S and a molecular weight of 622.78 g/mol. Its IUPAC name is [(10S,11S,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-[2-(4-methylphenyl)sulfonyloxyacetyl]-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] cyclohexanecarboxylate.
| Compound Name | [(10S,11S,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-[2-(4-methylphenyl)sulfonyloxyacetyl]-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 88763443 |
| Molecular Formula | C35H42O8S |
| Molecular Weight | 622.78 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | [(10S,11S,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-[2-(4-methylphenyl)sulfonyloxyacetyl]-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] cyclohexanecarboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(=O)[C@@]2(OC(=O)C3CCCCC3)CC[C@H]3C4=C([C@@H](O)C[C@@]32C)[C@@]2(C)C=CC(=O)C=C2CC4)cc1 |
| InChI | InChI=1S/C35H42O8S/c1-22-9-12-26(13-10-22)44(40,41)42-21-30(38)35(43-32(39)23-7-5-4-6-8-23)18-16-28-27-14-11-24-19-25(36)15-17-33(24,2)31(27)29(37)20-34(28,35)3/h9-10,12-13,15,17,19,23,28-29,37H,4-8,11,14,16,18,20-21H2,1-3H3/t28-,29-,33-,34-,35-/m0/s1 |
| InChIKey | XSQVCTHWPPKLEP-AVNMRTNVSA-N |
| XLogP | 5.47 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.78 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|