C25H29ClO5 — CID 57148822
[(10S,13S,14S,17R)-17-(2-chloroacetyl)-10,13-dimethyl-3,11-dioxo-6,7,12,14,15,16-hexahydrocyclopenta[a]phenanthren-17-yl] butanoate (PubChem CID 57148822) has the molecular formula C25H29ClO5 and a molecular weight of 444.96 g/mol. Its IUPAC name is [(10S,13S,14S,17R)-17-(2-chloroacetyl)-10,13-dimethyl-3,11-dioxo-6,7,12,14,15,16-hexahydrocyclopenta[a]phenanthren-17-yl] butanoate.
| Compound Name | [(10S,13S,14S,17R)-17-(2-chloroacetyl)-10,13-dimethyl-3,11-dioxo-6,7,12,14,15,16-hexahydrocyclopenta[a]phenanthren-17-yl] butanoate |
|---|---|
| PubChem CID | 57148822 |
| Molecular Formula | C25H29ClO5 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | [(10S,13S,14S,17R)-17-(2-chloroacetyl)-10,13-dimethyl-3,11-dioxo-6,7,12,14,15,16-hexahydrocyclopenta[a]phenanthren-17-yl] butanoate |
| SMILES | CCCC(=O)O[C@]1(C(=O)CCl)CC[C@H]2C3=C(C(=O)C[C@@]21C)[C@@]1(C)C=CC(=O)C=C1CC3 |
| InChI | InChI=1S/C25H29ClO5/c1-4-5-21(30)31-25(20(29)14-26)11-9-18-17-7-6-15-12-16(27)8-10-23(15,2)22(17)19(28)13-24(18,25)3/h8,10,12,18H,4-7,9,11,13-14H2,1-3H3/t18-,23-,24-,25-/m0/s1 |
| InChIKey | YSDRMNULDMEPSI-MGKKLRQFSA-N |
| XLogP | 4.43 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|