C34H42O8S — CID 88764152
[(10S,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-[2-(4-methylphenyl)sulfonyloxyacetyl]-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] hexanoate (PubChem CID 88764152) has the molecular formula C34H42O8S and a molecular weight of 610.77 g/mol. Its IUPAC name is [(10S,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-[2-(4-methylphenyl)sulfonyloxyacetyl]-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] hexanoate.
| Compound Name | [(10S,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-[2-(4-methylphenyl)sulfonyloxyacetyl]-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] hexanoate |
|---|---|
| PubChem CID | 88764152 |
| Molecular Formula | C34H42O8S |
| Molecular Weight | 610.77 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | [(10S,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-[2-(4-methylphenyl)sulfonyloxyacetyl]-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@]1(C(=O)COS(=O)(=O)c2ccc(C)cc2)CC[C@H]2C3=C(C(O)C[C@@]21C)[C@@]1(C)C=CC(=O)C=C1CC3 |
| InChI | InChI=1S/C34H42O8S/c1-5-6-7-8-30(38)42-34(29(37)21-41-43(39,40)25-12-9-22(2)10-13-25)18-16-27-26-14-11-23-19-24(35)15-17-32(23,3)31(26)28(36)20-33(27,34)4/h9-10,12-13,15,17,19,27-28,36H,5-8,11,14,16,18,20-21H2,1-4H3/t27-,28?,32-,33-,34-/m0/s1 |
| InChIKey | RDFRNTLDUDQEIE-WBSIORLFSA-N |
| XLogP | 5.47 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.77 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|