C32H38O8S — CID 57103049
[(10S,13S,14S,17R)-10,13-dimethyl-17-[2-(4-methylphenyl)sulfonyloxyacetyl]-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] 3-hydroxybutanoate (PubChem CID 57103049) has the molecular formula C32H38O8S and a molecular weight of 582.72 g/mol. Its IUPAC name is [(10S,13S,14S,17R)-10,13-dimethyl-17-[2-(4-methylphenyl)sulfonyloxyacetyl]-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] 3-hydroxybutanoate.
| Compound Name | [(10S,13S,14S,17R)-10,13-dimethyl-17-[2-(4-methylphenyl)sulfonyloxyacetyl]-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] 3-hydroxybutanoate |
|---|---|
| PubChem CID | 57103049 |
| Molecular Formula | C32H38O8S |
| Molecular Weight | 582.72 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | [(10S,13S,14S,17R)-10,13-dimethyl-17-[2-(4-methylphenyl)sulfonyloxyacetyl]-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] 3-hydroxybutanoate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(=O)[C@@]2(OC(=O)CC(C)O)CC[C@H]3C4=C(CC[C@@]32C)[C@@]2(C)C=CC(=O)C=C2CC4)cc1 |
| InChI | InChI=1S/C32H38O8S/c1-20-5-8-24(9-6-20)41(37,38)39-19-28(35)32(40-29(36)17-21(2)33)16-13-27-25-10-7-22-18-23(34)11-14-30(22,3)26(25)12-15-31(27,32)4/h5-6,8-9,11,14,18,21,27,33H,7,10,12-13,15-17,19H2,1-4H3/t21?,27-,30-,31-,32-/m0/s1 |
| InChIKey | KMFNMERPXDEXKE-RBQSAYFNSA-N |
| XLogP | 4.69 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.72 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|