C31H36O8S — CID 88763473
[(10S,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-[2-(4-methylphenyl)sulfonyloxyacetyl]-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 88763473) has the molecular formula C31H36O8S and a molecular weight of 568.69 g/mol. Its IUPAC name is [(10S,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-[2-(4-methylphenyl)sulfonyloxyacetyl]-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(10S,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-[2-(4-methylphenyl)sulfonyloxyacetyl]-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 88763473 |
| Molecular Formula | C31H36O8S |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | [(10S,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-[2-(4-methylphenyl)sulfonyloxyacetyl]-3-oxo-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@]1(C(=O)COS(=O)(=O)c2ccc(C)cc2)CC[C@H]2C3=C(C(O)C[C@@]21C)[C@@]1(C)C=CC(=O)C=C1CC3 |
| InChI | InChI=1S/C31H36O8S/c1-5-27(35)39-31(26(34)18-38-40(36,37)22-9-6-19(2)7-10-22)15-13-24-23-11-8-20-16-21(32)12-14-29(20,3)28(23)25(33)17-30(24,31)4/h6-7,9-10,12,14,16,24-25,33H,5,8,11,13,15,17-18H2,1-4H3/t24-,25?,29-,30-,31-/m0/s1 |
| InChIKey | PYUDBDSWDLKXMC-KKTCTFKQSA-N |
| XLogP | 4.30 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|