C24H41NO6S — CID 70567530
7-[(1R,2R,3R)-2-[(3S)-3-hydroxy-3-methyloct-1-enyl]-3-methyl-5-oxocyclopentyl]hept-5-enyl N-methylsulfonylcarbamate (PubChem CID 70567530) has the molecular formula C24H41NO6S and a molecular weight of 471.66 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-2-[(3S)-3-hydroxy-3-methyloct-1-enyl]-3-methyl-5-oxocyclopentyl]hept-5-enyl N-methylsulfonylcarbamate.
| Compound Name | 7-[(1R,2R,3R)-2-[(3S)-3-hydroxy-3-methyloct-1-enyl]-3-methyl-5-oxocyclopentyl]hept-5-enyl N-methylsulfonylcarbamate |
|---|---|
| PubChem CID | 70567530 |
| Molecular Formula | C24H41NO6S |
| Molecular Weight | 471.66 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | 7-[(1R,2R,3R)-2-[(3S)-3-hydroxy-3-methyloct-1-enyl]-3-methyl-5-oxocyclopentyl]hept-5-enyl N-methylsulfonylcarbamate |
| SMILES | CCCCC[C@](C)(O)C=C[C@H]1[C@H](C)CC(=O)[C@@H]1CC=CCCCCOC(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C24H41NO6S/c1-5-6-11-15-24(3,28)16-14-20-19(2)18-22(26)21(20)13-10-8-7-9-12-17-31-23(27)25-32(4,29)30/h8,10,14,16,19-21,28H,5-7,9,11-13,15,17-18H2,1-4H3,(H,25,27)/t19-,20+,21-,24+/m1/s1 |
| InChIKey | MVPKIFPBYHHWOR-WHLIWEHUSA-N |
| XLogP | 4.52 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.66 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|