C16H20ClN3O2 — CID 70567845
2-chloro-N-(2-methylphenyl)-N-[(5-propyl-1,3,4-oxadiazol-2-yl)methyl]propanamide (PubChem CID 70567845) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 2-chloro-N-(2-methylphenyl)-N-[(5-propyl-1,3,4-oxadiazol-2-yl)methyl]propanamide.
| Compound Name | 2-chloro-N-(2-methylphenyl)-N-[(5-propyl-1,3,4-oxadiazol-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 70567845 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-chloro-N-(2-methylphenyl)-N-[(5-propyl-1,3,4-oxadiazol-2-yl)methyl]propanamide |
| SMILES | CCCc1nnc(CN(C(=O)C(C)Cl)c2ccccc2C)o1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-4-7-14-18-19-15(22-14)10-20(16(21)12(3)17)13-9-6-5-8-11(13)2/h5-6,8-9,12H,4,7,10H2,1-3H3 |
| InChIKey | OJFJZGJNSYZOJU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|