C14H13Cl4N3OS — CID 70568326
2-chloro-N-(2-methylphenyl)-N-[[5-(trichloromethyl)-1,3,4-thiadiazol-2-yl]methyl]propanamide (PubChem CID 70568326) has the molecular formula C14H13Cl4N3OS and a molecular weight of 413.16 g/mol. Its IUPAC name is 2-chloro-N-(2-methylphenyl)-N-[[5-(trichloromethyl)-1,3,4-thiadiazol-2-yl]methyl]propanamide.
| Compound Name | 2-chloro-N-(2-methylphenyl)-N-[[5-(trichloromethyl)-1,3,4-thiadiazol-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 70568326 |
| Molecular Formula | C14H13Cl4N3OS |
| Molecular Weight | 413.16 g/mol |
| Exact Mass | 410.95 |
| IUPAC Name | 2-chloro-N-(2-methylphenyl)-N-[[5-(trichloromethyl)-1,3,4-thiadiazol-2-yl]methyl]propanamide |
| SMILES | Cc1ccccc1N(Cc1nnc(C(Cl)(Cl)Cl)s1)C(=O)C(C)Cl |
| InChI | InChI=1S/C14H13Cl4N3OS/c1-8-5-3-4-6-10(8)21(12(22)9(2)15)7-11-19-20-13(23-11)14(16,17)18/h3-6,9H,7H2,1-2H3 |
| InChIKey | VCNCCXYOSUIODC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.16 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|