C12H11Cl2N3O2 — CID 70568179
2,2-dichloro-N-(2-methylphenyl)-N-(1,3,4-oxadiazol-2-ylmethyl)acetamide (PubChem CID 70568179) has the molecular formula C12H11Cl2N3O2 and a molecular weight of 300.14 g/mol. Its IUPAC name is 2,2-dichloro-N-(2-methylphenyl)-N-(1,3,4-oxadiazol-2-ylmethyl)acetamide.
| Compound Name | 2,2-dichloro-N-(2-methylphenyl)-N-(1,3,4-oxadiazol-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 70568179 |
| Molecular Formula | C12H11Cl2N3O2 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 2,2-dichloro-N-(2-methylphenyl)-N-(1,3,4-oxadiazol-2-ylmethyl)acetamide |
| SMILES | Cc1ccccc1N(Cc1nnco1)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C12H11Cl2N3O2/c1-8-4-2-3-5-9(8)17(12(18)11(13)14)6-10-16-15-7-19-10/h2-5,7,11H,6H2,1H3 |
| InChIKey | OZHKYIAZRLCHTO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|