C15H15Cl4N3O2 — CID 70573315
2-chloro-N-(2-methylphenyl)-N-[[5-(trichloromethyl)-1,3,4-oxadiazol-2-yl]methyl]butanamide (PubChem CID 70573315) has the molecular formula C15H15Cl4N3O2 and a molecular weight of 411.12 g/mol. Its IUPAC name is 2-chloro-N-(2-methylphenyl)-N-[[5-(trichloromethyl)-1,3,4-oxadiazol-2-yl]methyl]butanamide.
| Compound Name | 2-chloro-N-(2-methylphenyl)-N-[[5-(trichloromethyl)-1,3,4-oxadiazol-2-yl]methyl]butanamide |
|---|---|
| PubChem CID | 70573315 |
| Molecular Formula | C15H15Cl4N3O2 |
| Molecular Weight | 411.12 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | 2-chloro-N-(2-methylphenyl)-N-[[5-(trichloromethyl)-1,3,4-oxadiazol-2-yl]methyl]butanamide |
| SMILES | CCC(Cl)C(=O)N(Cc1nnc(C(Cl)(Cl)Cl)o1)c1ccccc1C |
| InChI | InChI=1S/C15H15Cl4N3O2/c1-3-10(16)13(23)22(11-7-5-4-6-9(11)2)8-12-20-21-14(24-12)15(17,18)19/h4-7,10H,3,8H2,1-2H3 |
| InChIKey | ULQGWEOSEACMIM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.12 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|