C12H17N6O4S+ — CID 70569817
[2,6-diamino-4-(1-phenylpropan-2-ylamino)-1,3,5-triazin-1-ium-1-yl] hydrogen sulfate (PubChem CID 70569817) has the molecular formula C12H17N6O4S+ and a molecular weight of 341.37 g/mol. Its IUPAC name is [2,6-diamino-4-(1-phenylpropan-2-ylamino)-1,3,5-triazin-1-ium-1-yl] hydrogen sulfate.
| Compound Name | [2,6-diamino-4-(1-phenylpropan-2-ylamino)-1,3,5-triazin-1-ium-1-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 70569817 |
| Molecular Formula | C12H17N6O4S+ |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | [2,6-diamino-4-(1-phenylpropan-2-ylamino)-1,3,5-triazin-1-ium-1-yl] hydrogen sulfate |
| SMILES | CC(Cc1ccccc1)Nc1nc(N)[n+](OS(=O)(=O)O)c(N)n1 |
| InChI | InChI=1S/C12H16N6O4S/c1-8(7-9-5-3-2-4-6-9)15-12-16-10(13)18(11(14)17-12)22-23(19,20)21/h2-6,8H,7H2,1H3,(H5,13,14,15,16,17,19,20,21)/p+1 |
| InChIKey | RUBPGHJKZKVMRZ-UHFFFAOYSA-O |
| XLogP | -0.80 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|