C17H20O2 — CID 70579930
(2E)-5-methyl-2-(2-methylprop-2-enyl)-3-phenylhexa-2,5-dienoic acid (PubChem CID 70579930) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is (2E)-5-methyl-2-(2-methylprop-2-enyl)-3-phenylhexa-2,5-dienoic acid.
| Compound Name | (2E)-5-methyl-2-(2-methylprop-2-enyl)-3-phenylhexa-2,5-dienoic acid |
|---|---|
| PubChem CID | 70579930 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (2E)-5-methyl-2-(2-methylprop-2-enyl)-3-phenylhexa-2,5-dienoic acid |
| SMILES | C=C(C)C/C(C(=O)O)=C(/CC(=C)C)c1ccccc1 |
| InChI | InChI=1S/C17H20O2/c1-12(2)10-15(14-8-6-5-7-9-14)16(17(18)19)11-13(3)4/h5-9H,1,3,10-11H2,2,4H3,(H,18,19)/b16-15+ |
| InChIKey | MBCLKPUERZOUIU-FOCLMDBBSA-N |
| XLogP | 4.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|