C10H14FN2O3PS — CID 70584196
[amino(propylsulfanyl)phosphoryl] N-(4-fluorophenyl)carbamate (PubChem CID 70584196) has the molecular formula C10H14FN2O3PS and a molecular weight of 292.27 g/mol. Its IUPAC name is [amino(propylsulfanyl)phosphoryl] N-(4-fluorophenyl)carbamate.
| Compound Name | [amino(propylsulfanyl)phosphoryl] N-(4-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 70584196 |
| Molecular Formula | C10H14FN2O3PS |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | [amino(propylsulfanyl)phosphoryl] N-(4-fluorophenyl)carbamate |
| SMILES | CCCSP(N)(=O)OC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C10H14FN2O3PS/c1-2-7-18-17(12,15)16-10(14)13-9-5-3-8(11)4-6-9/h3-6H,2,7H2,1H3,(H2,12,15)(H,13,14) |
| InChIKey | LBXSFCNLDURRRY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|