C15H20N4S — CID 70592377
N'-(3,6-dihydro-2H-1,4-thiazin-5-yl)-N-phenylpyrrolidine-1-carboximidamide (PubChem CID 70592377) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is N'-(3,6-dihydro-2H-1,4-thiazin-5-yl)-N-phenylpyrrolidine-1-carboximidamide.
| Compound Name | N'-(3,6-dihydro-2H-1,4-thiazin-5-yl)-N-phenylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 70592377 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N'-(3,6-dihydro-2H-1,4-thiazin-5-yl)-N-phenylpyrrolidine-1-carboximidamide |
| SMILES | c1ccc(N/C(=N/C2=NCCSC2)N2CCCC2)cc1 |
| InChI | InChI=1S/C15H20N4S/c1-2-6-13(7-3-1)17-15(19-9-4-5-10-19)18-14-12-20-11-8-16-14/h1-3,6-7H,4-5,8-12H2,(H,16,17,18) |
| InChIKey | SIHVACSNNFJBON-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|