C14H19ClN4OS — CID 70538717
N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-phenylmorpholine-4-carboximidamide;hydrochloride (PubChem CID 70538717) has the molecular formula C14H19ClN4OS and a molecular weight of 326.85 g/mol. Its IUPAC name is N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-phenylmorpholine-4-carboximidamide;hydrochloride.
| Compound Name | N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-phenylmorpholine-4-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 70538717 |
| Molecular Formula | C14H19ClN4OS |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-phenylmorpholine-4-carboximidamide;hydrochloride |
| SMILES | Cl.c1ccc(NC(=NC2=NCCS2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C14H18N4OS.ClH/c1-2-4-12(5-3-1)16-13(17-14-15-6-11-20-14)18-7-9-19-10-8-18;/h1-5H,6-11H2,(H,15,16,17);1H |
| InChIKey | JTLAQTLTULSLSW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|