C17H16O6 — CID 70599857
2,2-bis[(2-hydroxyphenyl)methyl]propanedioic acid (PubChem CID 70599857) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is 2,2-bis[(2-hydroxyphenyl)methyl]propanedioic acid.
| Compound Name | 2,2-bis[(2-hydroxyphenyl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 70599857 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2,2-bis[(2-hydroxyphenyl)methyl]propanedioic acid |
| SMILES | O=C(O)C(Cc1ccccc1O)(Cc1ccccc1O)C(=O)O |
| InChI | InChI=1S/C17H16O6/c18-13-7-3-1-5-11(13)9-17(15(20)21,16(22)23)10-12-6-2-4-8-14(12)19/h1-8,18-19H,9-10H2,(H,20,21)(H,22,23) |
| InChIKey | RIIMFAUSMCKMAJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|