C17H31NO3 — CID 70604850
ethyl (E)-3-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)oxyprop-2-enoate (PubChem CID 70604850) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is ethyl (E)-3-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)oxyprop-2-enoate.
| Compound Name | ethyl (E)-3-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)oxyprop-2-enoate |
|---|---|
| PubChem CID | 70604850 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | ethyl (E)-3-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)oxyprop-2-enoate |
| SMILES | CCOC(=O)/C=C/OC1CC(C)(CC)NC(C)(CC)C1C |
| InChI | InChI=1S/C17H31NO3/c1-7-16(5)12-14(13(4)17(6,8-2)18-16)21-11-10-15(19)20-9-3/h10-11,13-14,18H,7-9,12H2,1-6H3/b11-10+ |
| InChIKey | OCQJCZOWRGSQLU-ZHACJKMWSA-N |
| XLogP | 3.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|