C16H29NO3 — CID 20506924
(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) 3-oxobutanoate (PubChem CID 20506924) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is (2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) 3-oxobutanoate.
| Compound Name | (2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) 3-oxobutanoate |
|---|---|
| PubChem CID | 20506924 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | (2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) 3-oxobutanoate |
| SMILES | CCC1(C)CC(OC(=O)CC(C)=O)C(C)C(C)(CC)N1 |
| InChI | InChI=1S/C16H29NO3/c1-7-15(5)10-13(20-14(19)9-11(3)18)12(4)16(6,8-2)17-15/h12-13,17H,7-10H2,1-6H3 |
| InChIKey | RQHIDYGXIWDONQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|