C24H29ClO7 — CID 70618715
(Z)-7-[(1R,2R,3R)-2-[(E)-2-[2-[(4-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 70618715) has the molecular formula C24H29ClO7 and a molecular weight of 464.94 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R)-2-[(E)-2-[2-[(4-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R)-2-[(E)-2-[2-[(4-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70618715 |
| Molecular Formula | C24H29ClO7 |
| Molecular Weight | 464.94 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | (Z)-7-[(1R,2R,3R)-2-[(E)-2-[2-[(4-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/C1(COc2ccc(Cl)cc2)OCCO1 |
| InChI | InChI=1S/C24H29ClO7/c25-17-7-9-18(10-8-17)30-16-24(31-13-14-32-24)12-11-20-19(21(26)15-22(20)27)5-3-1-2-4-6-23(28)29/h1,3,7-12,19-20,22,27H,2,4-6,13-16H2,(H,28,29)/b3-1-,12-11+/t19-,20-,22-/m1/s1 |
| InChIKey | DJLSQDOCLBWBDX-PGZSFBKPSA-N |
| XLogP | 3.79 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.94 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|