C23H29ClO6 — CID 70619074
(Z)-7-[(1R,2R,5S)-2-[2-[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]ethyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid (PubChem CID 70619074) has the molecular formula C23H29ClO6 and a molecular weight of 436.93 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,5S)-2-[2-[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]ethyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,5S)-2-[2-[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]ethyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70619074 |
| Molecular Formula | C23H29ClO6 |
| Molecular Weight | 436.93 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-2-[2-[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]ethyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@@H](O)CC(=O)[C@@H]1CCC1(c2ccc(Cl)cc2)OCCO1 |
| InChI | InChI=1S/C23H29ClO6/c24-17-9-7-16(8-10-17)23(29-13-14-30-23)12-11-19-18(20(25)15-21(19)26)5-3-1-2-4-6-22(27)28/h1,3,7-10,18-20,25H,2,4-6,11-15H2,(H,27,28)/b3-1-/t18-,19-,20+/m1/s1 |
| InChIKey | BKLSGOOHRCJHMK-GYLIKNLMSA-N |
| XLogP | 4.09 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.93 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|