C19H20Cl3IN2O6S — CID 70621502
1,1,2-trichloroethyl (6R)-3-iodo-7-methoxy-3-methyl-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 70621502) has the molecular formula C19H20Cl3IN2O6S and a molecular weight of 637.71 g/mol. Its IUPAC name is 1,1,2-trichloroethyl (6R)-3-iodo-7-methoxy-3-methyl-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | 1,1,2-trichloroethyl (6R)-3-iodo-7-methoxy-3-methyl-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 70621502 |
| Molecular Formula | C19H20Cl3IN2O6S |
| Molecular Weight | 637.71 g/mol |
| Exact Mass | 635.92 |
| IUPAC Name | 1,1,2-trichloroethyl (6R)-3-iodo-7-methoxy-3-methyl-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | COC1(NC(=O)COc2ccccc2)C(=O)N2C(C(=O)OC(Cl)(Cl)CCl)C(C)(I)CS[C@@H]21 |
| InChI | InChI=1S/C19H20Cl3IN2O6S/c1-17(23)10-32-16-19(29-2,24-12(26)8-30-11-6-4-3-5-7-11)15(28)25(16)13(17)14(27)31-18(21,22)9-20/h3-7,13,16H,8-10H2,1-2H3,(H,24,26)/t13?,16-,17?,19?/m1/s1 |
| InChIKey | AOCVVDZUAPLJIW-DEJXEUFVSA-N |
| XLogP | 2.92 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.71 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|