C9H12N4O6 — CID 70630294
5-N-(2-hydroxyethyl)pyridine-3,5-dicarboxamide;nitric acid (PubChem CID 70630294) has the molecular formula C9H12N4O6 and a molecular weight of 272.22 g/mol. Its IUPAC name is 5-N-(2-hydroxyethyl)pyridine-3,5-dicarboxamide;nitric acid.
| Compound Name | 5-N-(2-hydroxyethyl)pyridine-3,5-dicarboxamide;nitric acid |
|---|---|
| PubChem CID | 70630294 |
| Molecular Formula | C9H12N4O6 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 5-N-(2-hydroxyethyl)pyridine-3,5-dicarboxamide;nitric acid |
| SMILES | NC(=O)c1cncc(C(=O)NCCO)c1.O=[N+]([O-])O |
| InChI | InChI=1S/C9H11N3O3.HNO3/c10-8(14)6-3-7(5-11-4-6)9(15)12-1-2-13;2-1(3)4/h3-5,13H,1-2H2,(H2,10,14)(H,12,15);(H,2,3,4) |
| InChIKey | FIOBVFNRSBHZPC-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 168.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|