C11H17N5O2 — CID 70631102
3-piperazin-1-yl-1-(prop-2-enylamino)pyrimidine-2,4-dione (PubChem CID 70631102) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 3-piperazin-1-yl-1-(prop-2-enylamino)pyrimidine-2,4-dione.
| Compound Name | 3-piperazin-1-yl-1-(prop-2-enylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70631102 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 3-piperazin-1-yl-1-(prop-2-enylamino)pyrimidine-2,4-dione |
| SMILES | C=CCNn1ccc(=O)n(N2CCNCC2)c1=O |
| InChI | InChI=1S/C11H17N5O2/c1-2-4-13-15-7-3-10(17)16(11(15)18)14-8-5-12-6-9-14/h2-3,7,12-13H,1,4-6,8-9H2 |
| InChIKey | SNQQJGLAPVTRBY-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|