C19H27NO — CID 70636550
1-methyl-11-(2-methylbut-3-en-2-yl)-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol (PubChem CID 70636550) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is 1-methyl-11-(2-methylbut-3-en-2-yl)-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol.
| Compound Name | 1-methyl-11-(2-methylbut-3-en-2-yl)-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 70636550 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 1-methyl-11-(2-methylbut-3-en-2-yl)-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol |
| SMILES | C=CC(C)(C)N1CCC2(C)CC(Cc3ccc(O)cc32)C1 |
| InChI | InChI=1S/C19H27NO/c1-5-18(2,3)20-9-8-19(4)12-14(13-20)10-15-6-7-16(21)11-17(15)19/h5-7,11,14,21H,1,8-10,12-13H2,2-4H3 |
| InChIKey | HNAKUSSNOUPVAR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|