C29H36O3S — CID 70636912
(8S,10S,13S,14S,16R)-17-[2-(benzenesulfinyl)-1-methoxyethylidene]-10,13,16-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 70636912) has the molecular formula C29H36O3S and a molecular weight of 464.67 g/mol. Its IUPAC name is (8S,10S,13S,14S,16R)-17-[2-(benzenesulfinyl)-1-methoxyethylidene]-10,13,16-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10S,13S,14S,16R)-17-[2-(benzenesulfinyl)-1-methoxyethylidene]-10,13,16-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70636912 |
| Molecular Formula | C29H36O3S |
| Molecular Weight | 464.67 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | (8S,10S,13S,14S,16R)-17-[2-(benzenesulfinyl)-1-methoxyethylidene]-10,13,16-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | COC(CS(=O)c1ccccc1)=C1[C@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)C3=CC[C@]12C |
| InChI | InChI=1S/C29H36O3S/c1-19-16-25-23-11-10-20-17-21(30)12-14-28(20,2)24(23)13-15-29(25,3)27(19)26(32-4)18-33(31)22-8-6-5-7-9-22/h5-9,13,17,19,23,25H,10-12,14-16,18H2,1-4H3/t19-,23-,25+,28+,29+,33?/m1/s1 |
| InChIKey | RNYSSZFANKSVCO-ACKFPOQASA-N |
| XLogP | 6.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.67 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|