C17H29N7O2 — CID 70645852
2-[3-[[3-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-2-hydroxypropyl]amino]propyl]guanidine (PubChem CID 70645852) has the molecular formula C17H29N7O2 and a molecular weight of 363.47 g/mol. Its IUPAC name is 2-[3-[[3-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-2-hydroxypropyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[3-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-2-hydroxypropyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 70645852 |
| Molecular Formula | C17H29N7O2 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 2-[3-[[3-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-2-hydroxypropyl]amino]propyl]guanidine |
| SMILES | CC(C)(C)c1cc2cn(CC(O)CNCCCN=C(N)N)c(=O)nc2[nH]1 |
| InChI | InChI=1S/C17H29N7O2/c1-17(2,3)13-7-11-9-24(16(26)23-14(11)22-13)10-12(25)8-20-5-4-6-21-15(18)19/h7,9,12,20,25H,4-6,8,10H2,1-3H3,(H4,18,19,21)(H,22,23,26) |
| InChIKey | ZCJHPDJHWKULNP-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 147.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|