About N-hydrazinylidene-N'-phenylcarbamimidoyl fluoride
N-hydrazinylidene-N'-phenylcarbamimidoyl fluoride (PubChem CID 70651426) has the molecular formula C7H7FN4
and a molecular weight of 166.16 g/mol. Its IUPAC name is N-hydrazinylidene-N'-phenylcarbamimidoyl fluoride.
Molecular Properties
| Compound Name | N-hydrazinylidene-N'-phenylcarbamimidoyl fluoride |
| PubChem CID | 70651426 |
| Molecular Formula | C7H7FN4 |
| Molecular Weight | 166.16 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | N-hydrazinylidene-N'-phenylcarbamimidoyl fluoride |
| SMILES | NN=N/C(F)=N/c1ccccc1 |
| InChI | InChI=1S/C7H7FN4/c8-7(11-12-9)10-6-4-2-1-3-5-6/h1-5H,(H2,9,10,11) |
| InChIKey | KACHOHSTYCJMGF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.16 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-hydrazinylidene-N'-phenylcarbamimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydrazinylidene-N'-phenylcarbamimidoyl fluoride?
The IUPAC name of N-hydrazinylidene-N'-phenylcarbamimidoyl fluoride (CID 70651426) is N-hydrazinylidene-N'-phenylcarbamimidoyl fluoride.
What is the SMILES notation for N-hydrazinylidene-N'-phenylcarbamimidoyl fluoride?
The canonical SMILES for N-hydrazinylidene-N'-phenylcarbamimidoyl fluoride is NN=N/C(F)=N/c1ccccc1.
What is the InChIKey of N-hydrazinylidene-N'-phenylcarbamimidoyl fluoride?
The InChIKey is KACHOHSTYCJMGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FN4/c8-7(11-12-9)10-6-4-2-1-3-5-6/h1-5H,(H2,9,10,11).
What are the key properties of N-hydrazinylidene-N'-phenylcarbamimidoyl fluoride?
N-hydrazinylidene-N'-phenylcarbamimidoyl fluoride has a molecular weight of 166.16 g/mol, XLogP of 1.97, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydrazinylidene-N'-phenylcarbamimidoyl fluoride is sourced from PubChem (CID 70651426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).