C33H36N6O4 — CID 70656478
7-[[3H-benzimidazol-5-ylmethyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione (PubChem CID 70656478) has the molecular formula C33H36N6O4 and a molecular weight of 580.69 g/mol. Its IUPAC name is 7-[[3H-benzimidazol-5-ylmethyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione.
| Compound Name | 7-[[3H-benzimidazol-5-ylmethyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 70656478 |
| Molecular Formula | C33H36N6O4 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | 7-[[3H-benzimidazol-5-ylmethyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(CN(CCn3ccc4oc(C)cc4c3=O)Cc3ccc4nc[nH]c4c3)ccc21 |
| InChI | InChI=1S/C33H36N6O4/c1-6-39-27-10-8-23(17-28(27)36(5)31(41)33(3,4)32(39)42)19-37(18-22-7-9-25-26(16-22)35-20-34-25)13-14-38-12-11-29-24(30(38)40)15-21(2)43-29/h7-12,15-17,20H,6,13-14,18-19H2,1-5H3,(H,34,35) |
| InChIKey | TUNFSSZOUPYNEN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|