C23H32N4O6S2 — CID 70659937
2-[4-[(2S)-2-[[(3S)-3-methylmorpholin-4-yl]methyl]-4-(5-nitrothiophen-2-yl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 70659937) has the molecular formula C23H32N4O6S2 and a molecular weight of 524.67 g/mol. Its IUPAC name is 2-[4-[(2S)-2-[[(3S)-3-methylmorpholin-4-yl]methyl]-4-(5-nitrothiophen-2-yl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[(2S)-2-[[(3S)-3-methylmorpholin-4-yl]methyl]-4-(5-nitrothiophen-2-yl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 70659937 |
| Molecular Formula | C23H32N4O6S2 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 2-[4-[(2S)-2-[[(3S)-3-methylmorpholin-4-yl]methyl]-4-(5-nitrothiophen-2-yl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | C[C@H]1COCCN1C[C@H]1CN(S(=O)(=O)c2ccc([N+](=O)[O-])s2)CCN1c1ccc(C(C)(C)O)cc1 |
| InChI | InChI=1S/C23H32N4O6S2/c1-17-16-33-13-12-24(17)14-20-15-25(35(31,32)22-9-8-21(34-22)27(29)30)10-11-26(20)19-6-4-18(5-7-19)23(2,3)28/h4-9,17,20,28H,10-16H2,1-3H3/t17-,20-/m0/s1 |
| InChIKey | GUCLJAXZRJKSBS-PXNSSMCTSA-N |
| XLogP | 2.48 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|