C25H32F3N3O5S2 — CID 87059040
2-[(3S)-3-[[(3S)-3-methylmorpholin-4-yl]methyl]-4-[4-(1,1,1-trifluoro-2,3-dihydroxypropan-2-yl)phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione (PubChem CID 87059040) has the molecular formula C25H32F3N3O5S2 and a molecular weight of 575.68 g/mol. Its IUPAC name is 2-[(3S)-3-[[(3S)-3-methylmorpholin-4-yl]methyl]-4-[4-(1,1,1-trifluoro-2,3-dihydroxypropan-2-yl)phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione.
| Compound Name | 2-[(3S)-3-[[(3S)-3-methylmorpholin-4-yl]methyl]-4-[4-(1,1,1-trifluoro-2,3-dihydroxypropan-2-yl)phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 87059040 |
| Molecular Formula | C25H32F3N3O5S2 |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.17 |
| IUPAC Name | 2-[(3S)-3-[[(3S)-3-methylmorpholin-4-yl]methyl]-4-[4-(1,1,1-trifluoro-2,3-dihydroxypropan-2-yl)phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
| SMILES | C[C@H]1COCCN1C[C@H]1CN(S(=O)(=O)C2=CC=CCC2=S)CCN1c1ccc(C(O)(CO)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H32F3N3O5S2/c1-18-16-36-13-12-29(18)14-21-15-30(38(34,35)23-5-3-2-4-22(23)37)10-11-31(21)20-8-6-19(7-9-20)24(33,17-32)25(26,27)28/h2-3,5-9,18,21,32-33H,4,10-17H2,1H3/t18-,21-,24?/m0/s1 |
| InChIKey | XMIKGUVTIPVQQZ-BNVZOUMQSA-N |
| XLogP | 2.18 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|